*
chemistry Formula Molecular weight IUPAC surname SMILES wire InChI InChIKey
F10S2
254.11403 g/mol
1,1,1,1,1,2,2,2,2,2-decafluoro-1$l^6,2$l^6-disulfane
FS(F)(F)(F)(F)S(F)(F)(F)(F)F
InChI=1S/F10S2/c1-11(2,3,4,5)12(6,7,8,9)10
BPFZRKQDXVZTFD-UHFFFAOYSA-N



You are watching: What is the formula for disulfur decafluoride ?

The DISULFUR DECAFLUORIDE molecule consists of a complete of 12 atom(s). There space 2 Sulfur atom(s) and also 10 Fluorine atom(s). A chemistry formula that DISULFUR DECAFLUORIDE can therefore be written as:

F10S2

The chemical formula of DISULFUR DECAFLUORIDE shown over is based upon the molecular formula indicating the numbers of each form of atom in a molecule without structural information, i m sorry is different from the empirical formula which gives the numerical proportions of atoms of each type. The over chemical formula is the communication of stoichiometry in chemistry equations, i.e., the calculate of relative amounts of reactants and also products in chemical reactions. The regulation of preservation of massive dictates that the amount of each facet given in the chemical formula go not change in a chemical reaction. Thus, every side of the chemistry equation should represent the same amount of any certain element based on the chemical formula.


*
Ball-and-stick model of DISULFUR DECAFLUORIDE

More properties of DISULFUR DECAFLUORIDE

because that physicochemical, thermodynamic, transport, spectra, and other building data & information, the followings are easily accessible from “Mol-Instincts”, a chemical database based on quantum mechanics:

Quantum Mechanical evaluation molecule Descriptors

Additional info for identify DISULFUR DECAFLUORIDE Molecule

InChI (IUPAC global Chemical Identifier) details of DISULFUR DECAFLUORIDE

The molecular chemistry formulas absence structural information. An different textual expression including the structural details is InChI. The complete standard InChI the DISULFUR DECAFLUORIDE is:

InChI=1S/F10S2/c1-11(2,3,4,5)12(6,7,8,9)10

it can carry out a standard means to encode the molecular info of DISULFUR DECAFLUORIDE come facilitate the search for the compound information in databases and also on the web.

The condensed, 27 character standard InChIKey (hashed variation of the complete standard InChI) the DISULFUR DECAFLUORIDE is:

InChIKey=BPFZRKQDXVZTFD-UHFFFAOYSA-N

The InChIKey may enable easier internet searches because that DISULFUR DECAFLUORIDE, yet it needs to be attached to the full InChI to get ago to the initial structure of the DISULFUR DECAFLUORIDE due to the fact that the complete standard InChI can not be reconstructed from the InChIKey.

Other names (synonyms) or registry numbers of DISULFUR DECAFLUORIDE

The DISULFUR DECAFLUORIDE compound may have different names depending upon the various different instances of commercial applications. The perform of the other names (synonyms) that DISULFUR DECAFLUORIDE including the registry numbers is offered below, if available:




See more: How Many Cups Is 7 Oz Of Flour To Cups Conversion (Oz To C), Baking Ingredient Conversions

pentakis(fluoranyl)--$l^6-sulfane1,1,1,1,1,2,2,2,2,2-decafluoro-1|E6,2|E6-disulfanepentafluoro-(pentafluoro-$l^6-sulfanyl)-$l^6-sulfaneC-15727A831326MFCD00800978ZX-AP007382S2F105XG19I842OTL 70DisulfurdecafluorideSulfur fluoride (S2F10)5714-22-7Sulfur pentafluorideSulfur decafluorideDisulphur decafluorideDISULFUR DECAFLUORIDE

Additional superior Products

DISULFUR DECAFLUORIDE Identification summary Frequently Asked concerns (FAQs)

what’s the chemical formula of DISULFUR DECAFLUORIDE? How numerous atoms and also what room they in the DISULFUR DECAFLUORIDE structure? How countless chemical bonds and what space they in the DISULFUR DECAFLUORIDE structure? those the molecular load of DISULFUR DECAFLUORIDE? what’s the SMILES cable of DISULFUR DECAFLUORIDE? those the InChI that DISULFUR DECAFLUORIDE? what’s the InChIKey that DISULFUR DECAFLUORIDE?
F10S2
12 atom(s) - 2 Sulfur atom(s) and also 10 Fluorine atom(s)
11 bond(s) - 11 non-H bond(s)
254.11403 g/mol
FS(F)(F)(F)(F)S(F)(F)(F)(F)F
InChI=1S/F10S2/c1-11(2,3,4,5)12(6,7,8,9)10
BPFZRKQDXVZTFD-UHFFFAOYSA-N

4526 The contents of this web page can freely be common if cited together follows: Source: Mol-Instincts chemistry Database, suspect on Quantum. You re welcome hyperlink "Mol-Instincts" come www.betterworld2016.org.