| F10S2 |
| 254.11403 g/mol |
| 1,1,1,1,1,2,2,2,2,2-decafluoro-1$l^6,2$l^6-disulfane |
| FS(F)(F)(F)(F)S(F)(F)(F)(F)F |
| InChI=1S/F10S2/c1-11(2,3,4,5)12(6,7,8,9)10 |
| BPFZRKQDXVZTFD-UHFFFAOYSA-N |
You are watching: What is the formula for disulfur decafluoride ?
The DISULFUR DECAFLUORIDE molecule consists of a complete of 12 atom(s). There space 2 Sulfur atom(s) and also 10 Fluorine atom(s). A chemistry formula that DISULFUR DECAFLUORIDE can therefore be written as:
F10S2
The chemical formula of DISULFUR DECAFLUORIDE shown over is based upon the molecular formula indicating the numbers of each form of atom in a molecule without structural information, i m sorry is different from the empirical formula which gives the numerical proportions of atoms of each type. The over chemical formula is the communication of stoichiometry in chemistry equations, i.e., the calculate of relative amounts of reactants and also products in chemical reactions. The regulation of preservation of massive dictates that the amount of each facet given in the chemical formula go not change in a chemical reaction. Thus, every side of the chemistry equation should represent the same amount of any certain element based on the chemical formula.
More properties of DISULFUR DECAFLUORIDE
because that physicochemical, thermodynamic, transport, spectra, and other building data & information, the followings are easily accessible from “Mol-Instincts”, a chemical database based on quantum mechanics:
Quantum Mechanical evaluation molecule DescriptorsAdditional info for identify DISULFUR DECAFLUORIDE Molecule
InChI (IUPAC global Chemical Identifier) details of DISULFUR DECAFLUORIDE
The molecular chemistry formulas absence structural information. An different textual expression including the structural details is InChI. The complete standard InChI the DISULFUR DECAFLUORIDE is:
InChI=1S/F10S2/c1-11(2,3,4,5)12(6,7,8,9)10
it can carry out a standard means to encode the molecular info of DISULFUR DECAFLUORIDE come facilitate the search for the compound information in databases and also on the web.
The condensed, 27 character standard InChIKey (hashed variation of the complete standard InChI) the DISULFUR DECAFLUORIDE is:
InChIKey=BPFZRKQDXVZTFD-UHFFFAOYSA-N
The InChIKey may enable easier internet searches because that DISULFUR DECAFLUORIDE, yet it needs to be attached to the full InChI to get ago to the initial structure of the DISULFUR DECAFLUORIDE due to the fact that the complete standard InChI can not be reconstructed from the InChIKey.
Other names (synonyms) or registry numbers of DISULFUR DECAFLUORIDE
The DISULFUR DECAFLUORIDE compound may have different names depending upon the various different instances of commercial applications. The perform of the other names (synonyms) that DISULFUR DECAFLUORIDE including the registry numbers is offered below, if available:
See more: How Many Cups Is 7 Oz Of Flour To Cups Conversion (Oz To C), Baking Ingredient Conversions
pentakis(fluoranyl)-
Additional superior Products
DISULFUR DECAFLUORIDE Identification summary Frequently Asked concerns (FAQs)
| F10S2 |
| 12 atom(s) - 2 Sulfur atom(s) and also 10 Fluorine atom(s) |
| 11 bond(s) - 11 non-H bond(s) |
| 254.11403 g/mol |
| FS(F)(F)(F)(F)S(F)(F)(F)(F)F |
| InChI=1S/F10S2/c1-11(2,3,4,5)12(6,7,8,9)10 |
| BPFZRKQDXVZTFD-UHFFFAOYSA-N |
4526 The contents of this web page can freely be common if cited together follows: Source: Mol-Instincts chemistry Database, suspect on Quantum. You re welcome hyperlink "Mol-Instincts" come www.betterworld2016.org.